C17H17BrFN — CID 61070069
5-bromo-N-[1-(4-fluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 61070069) has the molecular formula C17H17BrFN and a molecular weight of 334.23 g/mol. Its IUPAC name is 5-bromo-N-[1-(4-fluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-bromo-N-[1-(4-fluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 61070069 |
| Molecular Formula | C17H17BrFN |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5-bromo-N-[1-(4-fluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(NC1CCc2cc(Br)ccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17BrFN/c1-11(12-2-6-15(19)7-3-12)20-17-9-4-13-10-14(18)5-8-16(13)17/h2-3,5-8,10-11,17,20H,4,9H2,1H3 |
| InChIKey | WUJLMIAXIMIFEG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |