C15H16BrNS — CID 103901794
4-bromo-N-(1-thiophen-3-ylethyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 103901794) has the molecular formula C15H16BrNS and a molecular weight of 322.27 g/mol. Its IUPAC name is 4-bromo-N-(1-thiophen-3-ylethyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-bromo-N-(1-thiophen-3-ylethyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103901794 |
| Molecular Formula | C15H16BrNS |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-bromo-N-(1-thiophen-3-ylethyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(NC1CCc2c(Br)cccc21)c1ccsc1 |
| InChI | InChI=1S/C15H16BrNS/c1-10(11-7-8-18-9-11)17-15-6-5-12-13(15)3-2-4-14(12)16/h2-4,7-10,15,17H,5-6H2,1H3 |
| InChIKey | SKSYYLDUWZYZPC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |