C13H16Cl2FNO2S — CID 107573956
3,5-dichloro-4-fluoro-N-(3-methylsulfonylcyclohexyl)aniline (PubChem CID 107573956) has the molecular formula C13H16Cl2FNO2S and a molecular weight of 340.25 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-(3-methylsulfonylcyclohexyl)aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-(3-methylsulfonylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107573956 |
| Molecular Formula | C13H16Cl2FNO2S |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-(3-methylsulfonylcyclohexyl)aniline |
| SMILES | CS(=O)(=O)C1CCCC(Nc2cc(Cl)c(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H16Cl2FNO2S/c1-20(18,19)10-4-2-3-8(5-10)17-9-6-11(14)13(16)12(15)7-9/h6-8,10,17H,2-5H2,1H3 |
| InChIKey | QZFIRXBFSSVCCE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|