C13H19Cl2N3O2S — CID 105248750
[(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 105248750) has the molecular formula C13H19Cl2N3O2S and a molecular weight of 352.29 g/mol. Its IUPAC name is [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105248750 |
| Molecular Formula | C13H19Cl2N3O2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | CS(=O)(=O)C1CCCC(C(NN)c2ncc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H19Cl2N3O2S/c1-21(19,20)10-4-2-3-8(5-10)12(18-16)13-11(15)6-9(14)7-17-13/h6-8,10,12,18H,2-5,16H2,1H3 |
| InChIKey | SLBMGUPPLNGWSB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|