About [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine
[(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 105248750) has the molecular formula C13H19Cl2N3O2S
and a molecular weight of 352.29 g/mol. Its IUPAC name is [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
Molecular Properties
| Compound Name | [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| PubChem CID | 105248750 |
| Molecular Formula | C13H19Cl2N3O2S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | CS(=O)(=O)C1CCCC(C(NN)c2ncc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H19Cl2N3O2S/c1-21(19,20)10-4-2-3-8(5-10)12(18-16)13-11(15)6-9(14)7-17-13/h6-8,10,12,18H,2-5,16H2,1H3 |
| InChIKey | SLBMGUPPLNGWSB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The IUPAC name of [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (CID 105248750) is [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
What is the SMILES notation for [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The canonical SMILES for [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine is CS(=O)(=O)C1CCCC(C(NN)c2ncc(Cl)cc2Cl)C1.
What is the InChIKey of [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
The InChIKey is SLBMGUPPLNGWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl2N3O2S/c1-21(19,20)10-4-2-3-8(5-10)12(18-16)13-11(15)6-9(14)7-17-13/h6-8,10,12,18H,2-5,16H2,1H3.
What are the key properties of [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine?
[(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine has a molecular weight of 352.29 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dichloro-2-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine is sourced from PubChem (CID 105248750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).