C13H22N4O3S — CID 102953369
[(6-methoxypyrimidin-4-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 102953369) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is [(6-methoxypyrimidin-4-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
| Compound Name | [(6-methoxypyrimidin-4-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 102953369 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(6-methoxypyrimidin-4-yl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | COc1cc(C(NN)C2CCCC(S(C)(=O)=O)C2)ncn1 |
| InChI | InChI=1S/C13H22N4O3S/c1-20-12-7-11(15-8-16-12)13(17-14)9-4-3-5-10(6-9)21(2,18)19/h7-10,13,17H,3-6,14H2,1-2H3 |
| InChIKey | BERXPESFBISQRB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|