C14H23N3O2S — CID 105324276
[(5-methyl-3-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine (PubChem CID 105324276) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is [(5-methyl-3-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine.
| Compound Name | [(5-methyl-3-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105324276 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [(5-methyl-3-pyridinyl)-(3-methylsulfonylcyclohexyl)methyl]hydrazine |
| SMILES | Cc1cncc(C(NN)C2CCCC(S(C)(=O)=O)C2)c1 |
| InChI | InChI=1S/C14H23N3O2S/c1-10-6-12(9-16-8-10)14(17-15)11-4-3-5-13(7-11)20(2,18)19/h6,8-9,11,13-14,17H,3-5,7,15H2,1-2H3 |
| InChIKey | JAJUMKMHWBDKEW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|