C12H14Cl2FNO — CID 107572751
4-(3,5-dichloro-4-fluoroanilino)cyclohexan-1-ol (PubChem CID 107572751) has the molecular formula C12H14Cl2FNO and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-fluoroanilino)cyclohexan-1-ol.
| Compound Name | 4-(3,5-dichloro-4-fluoroanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 107572751 |
| Molecular Formula | C12H14Cl2FNO |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-(3,5-dichloro-4-fluoroanilino)cyclohexan-1-ol |
| SMILES | OC1CCC(Nc2cc(Cl)c(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14Cl2FNO/c13-10-5-8(6-11(14)12(10)15)16-7-1-3-9(17)4-2-7/h5-7,9,16-17H,1-4H2 |
| InChIKey | XUQOPDWTTCQLHA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|