C13H16BrCl2NO2S — CID 107788960
4-bromo-2,3-dichloro-N-(3-methylsulfonylcyclohexyl)aniline (PubChem CID 107788960) has the molecular formula C13H16BrCl2NO2S and a molecular weight of 401.15 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(3-methylsulfonylcyclohexyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(3-methylsulfonylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107788960 |
| Molecular Formula | C13H16BrCl2NO2S |
| Molecular Weight | 401.15 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(3-methylsulfonylcyclohexyl)aniline |
| SMILES | CS(=O)(=O)C1CCCC(Nc2ccc(Br)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C13H16BrCl2NO2S/c1-20(18,19)9-4-2-3-8(7-9)17-11-6-5-10(14)12(15)13(11)16/h5-6,8-9,17H,2-4,7H2,1H3 |
| InChIKey | GTGPTDJQJLWVMM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|