C13H15BrCl2N2 — CID 107788003
N-(4-bromo-2,3-dichlorophenyl)-1-cyclopropylpyrrolidin-3-amine (PubChem CID 107788003) has the molecular formula C13H15BrCl2N2 and a molecular weight of 350.09 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-cyclopropylpyrrolidin-3-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyclopropylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 107788003 |
| Molecular Formula | C13H15BrCl2N2 |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-cyclopropylpyrrolidin-3-amine |
| SMILES | Clc1c(Br)ccc(NC2CCN(C3CC3)C2)c1Cl |
| InChI | InChI=1S/C13H15BrCl2N2/c14-10-3-4-11(13(16)12(10)15)17-8-5-6-18(7-8)9-1-2-9/h3-4,8-9,17H,1-2,5-7H2 |
| InChIKey | PYCSUIQRHIDFJX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|