C12H17ClN4O — CID 115611041
4-chloro-5-[(1-cyclopropylpyrrolidin-3-yl)amino]-2-methylpyridazin-3-one (PubChem CID 115611041) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 4-chloro-5-[(1-cyclopropylpyrrolidin-3-yl)amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(1-cyclopropylpyrrolidin-3-yl)amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 115611041 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-chloro-5-[(1-cyclopropylpyrrolidin-3-yl)amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC2CCN(C3CC3)C2)c(Cl)c1=O |
| InChI | InChI=1S/C12H17ClN4O/c1-16-12(18)11(13)10(6-14-16)15-8-4-5-17(7-8)9-2-3-9/h6,8-9,15H,2-5,7H2,1H3 |
| InChIKey | OZWDDISEJPZWIX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |