C22H34Cl2N8O2 — CID 158190785
4-chloro-2-methyl-5-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-one (PubChem CID 158190785) has the molecular formula C22H34Cl2N8O2 and a molecular weight of 513.47 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-methyl-5-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 158190785 |
| Molecular Formula | C22H34Cl2N8O2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 4-chloro-2-methyl-5-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-one |
| SMILES | CN1CCC[C@@H](Nc2cnn(C)c(=O)c2Cl)C1.CN1CCC[C@@H](Nc2cnn(C)c(=O)c2Cl)C1 |
| InChI | InChI=1S/2C11H17ClN4O/c2*1-15-5-3-4-8(7-15)14-9-6-13-16(2)11(17)10(9)12/h2*6,8,14H,3-5,7H2,1-2H3/t2*8-/m11/s1 |
| InChIKey | FZSNGVMXZATSSK-NWKMIUOTSA-N |
| XLogP | 1.88 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |