C10H14ClN3O3S — CID 115657637
4-chloro-5-[(1,1-dioxothian-3-yl)amino]-2-methylpyridazin-3-one (PubChem CID 115657637) has the molecular formula C10H14ClN3O3S and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-chloro-5-[(1,1-dioxothian-3-yl)amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[(1,1-dioxothian-3-yl)amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 115657637 |
| Molecular Formula | C10H14ClN3O3S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 4-chloro-5-[(1,1-dioxothian-3-yl)amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC2CCCS(=O)(=O)C2)c(Cl)c1=O |
| InChI | InChI=1S/C10H14ClN3O3S/c1-14-10(15)9(11)8(5-12-14)13-7-3-2-4-18(16,17)6-7/h5,7,13H,2-4,6H2,1H3 |
| InChIKey | PMMODDYBZQFSHC-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |