C16H25ClN4O2 — CID 133376432
4-chloro-5-[[1-(2-hydroxycyclohexyl)piperidin-4-yl]amino]-2-methylpyridazin-3-one (PubChem CID 133376432) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 4-chloro-5-[[1-(2-hydroxycyclohexyl)piperidin-4-yl]amino]-2-methylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[1-(2-hydroxycyclohexyl)piperidin-4-yl]amino]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 133376432 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-chloro-5-[[1-(2-hydroxycyclohexyl)piperidin-4-yl]amino]-2-methylpyridazin-3-one |
| SMILES | Cn1ncc(NC2CCN(C3CCCCC3O)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C16H25ClN4O2/c1-20-16(23)15(17)12(10-18-20)19-11-6-8-21(9-7-11)13-4-2-3-5-14(13)22/h10-11,13-14,19,22H,2-9H2,1H3 |
| InChIKey | DHSQINXHLNUFTQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |