C12H17ClN4S — CID 80546981
6-chloro-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80546981) has the molecular formula C12H17ClN4S and a molecular weight of 284.82 g/mol. Its IUPAC name is 6-chloro-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80546981 |
| Molecular Formula | C12H17ClN4S |
| Molecular Weight | 284.82 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 6-chloro-N-(1-cyclopropylpyrrolidin-3-yl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(Cl)cc(NC2CCN(C3CC3)C2)n1 |
| InChI | InChI=1S/C12H17ClN4S/c1-18-12-15-10(13)6-11(16-12)14-8-4-5-17(7-8)9-2-3-9/h6,8-9H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | GEWSDAMBDMBXEY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |