C12H20N6S — CID 80904074
N-(1-cyclopropylpyrrolidin-3-yl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine (PubChem CID 80904074) has the molecular formula C12H20N6S and a molecular weight of 280.40 g/mol. Its IUPAC name is N-(1-cyclopropylpyrrolidin-3-yl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-(1-cyclopropylpyrrolidin-3-yl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80904074 |
| Molecular Formula | C12H20N6S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(1-cyclopropylpyrrolidin-3-yl)-6-hydrazinyl-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1nc(NN)cc(NC2CCN(C3CC3)C2)n1 |
| InChI | InChI=1S/C12H20N6S/c1-19-12-15-10(6-11(16-12)17-13)14-8-4-5-18(7-8)9-2-3-9/h6,8-9H,2-5,7,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | XGPRTNAJXYQOTM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|