C10H10BrCl2N — CID 107787892
4-bromo-2,3-dichloro-N-cyclobutylaniline (PubChem CID 107787892) has the molecular formula C10H10BrCl2N and a molecular weight of 295.01 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-cyclobutylaniline.
| Compound Name | 4-bromo-2,3-dichloro-N-cyclobutylaniline |
|---|---|
| PubChem CID | 107787892 |
| Molecular Formula | C10H10BrCl2N |
| Molecular Weight | 295.01 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-cyclobutylaniline |
| SMILES | Clc1c(Br)ccc(NC2CCC2)c1Cl |
| InChI | InChI=1S/C10H10BrCl2N/c11-7-4-5-8(10(13)9(7)12)14-6-2-1-3-6/h4-6,14H,1-3H2 |
| InChIKey | YGFVIOOTUNTTGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|