C14H12BrCl2NS — CID 107787596
N-(4-bromo-2,3-dichlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 107787596) has the molecular formula C14H12BrCl2NS and a molecular weight of 377.13 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 107787596 |
| Molecular Formula | C14H12BrCl2NS |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Clc1c(Br)ccc(NC2CCCc3sccc32)c1Cl |
| InChI | InChI=1S/C14H12BrCl2NS/c15-9-4-5-11(14(17)13(9)16)18-10-2-1-3-12-8(10)6-7-19-12/h4-7,10,18H,1-3H2 |
| InChIKey | AVMZZXDDWRJFFD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|