C14H12BrFN2O2S — CID 66112434
N-(4-bromo-5-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 66112434) has the molecular formula C14H12BrFN2O2S and a molecular weight of 371.23 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(4-bromo-5-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 66112434 |
| Molecular Formula | C14H12BrFN2O2S |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-nitrophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | O=[N+]([O-])c1cc(Br)c(F)cc1NC1CCCc2sccc21 |
| InChI | InChI=1S/C14H12BrFN2O2S/c15-9-6-13(18(19)20)12(7-10(9)16)17-11-2-1-3-14-8(11)4-5-21-14/h4-7,11,17H,1-3H2 |
| InChIKey | KRZNOBHVDKEOJU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|