C14H13FINS — CID 114258382
N-(3-fluoro-2-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 114258382) has the molecular formula C14H13FINS and a molecular weight of 373.23 g/mol. Its IUPAC name is N-(3-fluoro-2-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(3-fluoro-2-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 114258382 |
| Molecular Formula | C14H13FINS |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | N-(3-fluoro-2-iodophenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Fc1cccc(NC2CCCc3sccc32)c1I |
| InChI | InChI=1S/C14H13FINS/c15-10-3-1-5-12(14(10)16)17-11-4-2-6-13-9(11)7-8-18-13/h1,3,5,7-8,11,17H,2,4,6H2 |
| InChIKey | ASXFAKZUHQBNJH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|