C18H21NS — CID 63418984
N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 63418984) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 63418984 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | c1cc2c(c(NC3CCCc4sccc43)c1)CCCC2 |
| InChI | InChI=1S/C18H21NS/c1-2-7-14-13(5-1)6-3-8-16(14)19-17-9-4-10-18-15(17)11-12-20-18/h3,6,8,11-12,17,19H,1-2,4-5,7,9-10H2 |
| InChIKey | BMHOHLTZRSAONV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |