About N-cyclopropyl-2,3-dihydro-1H-inden-4-amine
N-cyclopropyl-2,3-dihydro-1H-inden-4-amine (PubChem CID 91150156) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-cyclopropyl-2,3-dihydro-1H-inden-4-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-2,3-dihydro-1H-inden-4-amine |
| PubChem CID | 91150156 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-cyclopropyl-2,3-dihydro-1H-inden-4-amine |
| SMILES | c1cc2c(c(NC3CC3)c1)CCC2 |
| InChI | InChI=1S/C12H15N/c1-3-9-4-2-6-12(11(9)5-1)13-10-7-8-10/h2,4,6,10,13H,1,3,5,7-8H2 |
| InChIKey | LZRBWUSQQMSGCF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-2,3-dihydro-1H-inden-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,3-dihydro-1H-inden-4-amine?
The IUPAC name of N-cyclopropyl-2,3-dihydro-1H-inden-4-amine (CID 91150156) is N-cyclopropyl-2,3-dihydro-1H-inden-4-amine.
What is the SMILES notation for N-cyclopropyl-2,3-dihydro-1H-inden-4-amine?
The canonical SMILES for N-cyclopropyl-2,3-dihydro-1H-inden-4-amine is c1cc2c(c(NC3CC3)c1)CCC2.
What is the InChIKey of N-cyclopropyl-2,3-dihydro-1H-inden-4-amine?
The InChIKey is LZRBWUSQQMSGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-3-9-4-2-6-12(11(9)5-1)13-10-7-8-10/h2,4,6,10,13H,1,3,5,7-8H2.
What are the key properties of N-cyclopropyl-2,3-dihydro-1H-inden-4-amine?
N-cyclopropyl-2,3-dihydro-1H-inden-4-amine has a molecular weight of 173.26 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,3-dihydro-1H-inden-4-amine is sourced from PubChem (CID 91150156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).