C15H21NS — CID 62872683
N-(5,6,7,8-tetrahydronaphthalen-1-yl)thian-3-amine (PubChem CID 62872683) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-1-yl)thian-3-amine.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)thian-3-amine |
|---|---|
| PubChem CID | 62872683 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)thian-3-amine |
| SMILES | c1cc2c(c(NC3CCCSC3)c1)CCCC2 |
| InChI | InChI=1S/C15H21NS/c1-2-8-14-12(5-1)6-3-9-15(14)16-13-7-4-10-17-11-13/h3,6,9,13,16H,1-2,4-5,7-8,10-11H2 |
| InChIKey | ZXUAZIPXUXJMBA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |