C12H17N — CID 129164369
N-propyl-2,3-dihydro-1H-inden-4-amine (PubChem CID 129164369) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-propyl-2,3-dihydro-1H-inden-4-amine.
| Compound Name | N-propyl-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 129164369 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-propyl-2,3-dihydro-1H-inden-4-amine |
| SMILES | CCCNc1cccc2c1CCC2 |
| InChI | InChI=1S/C12H17N/c1-2-9-13-12-8-4-6-10-5-3-7-11(10)12/h4,6,8,13H,2-3,5,7,9H2,1H3 |
| InChIKey | LUMPHGWWESORPM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |