C18H29N — CID 43129204
N-octyl-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 43129204) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is N-octyl-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-octyl-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 43129204 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-octyl-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | CCCCCCCCNc1cccc2c1CCCC2 |
| InChI | InChI=1S/C18H29N/c1-2-3-4-5-6-9-15-19-18-14-10-12-16-11-7-8-13-17(16)18/h10,12,14,19H,2-9,11,13,15H2,1H3 |
| InChIKey | DDAVSYBHWXWELG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|