C15H19N — CID 115871884
N-pent-4-ynyl-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 115871884) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is N-pent-4-ynyl-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-pent-4-ynyl-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 115871884 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | N-pent-4-ynyl-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | C#CCCCNc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H19N/c1-2-3-6-12-16-15-11-7-9-13-8-4-5-10-14(13)15/h1,7,9,11,16H,3-6,8,10,12H2 |
| InChIKey | BBMZNMWUYQTVJZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|