C19H19N — CID 62341212
N-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 62341212) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 62341212 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(3-phenylprop-2-ynyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | C(#Cc1ccccc1)CNc1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H19N/c1-2-8-16(9-3-1)10-7-15-20-19-14-6-12-17-11-4-5-13-18(17)19/h1-3,6,8-9,12,14,20H,4-5,11,13,15H2 |
| InChIKey | YSNKIIRJGKDDBZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|