C14H21NO2 — CID 55233075
N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 55233075) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 55233075 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | COC(CNc1cccc2c1CCCC2)OC |
| InChI | InChI=1S/C14H21NO2/c1-16-14(17-2)10-15-13-9-5-7-11-6-3-4-8-12(11)13/h5,7,9,14-15H,3-4,6,8,10H2,1-2H3 |
| InChIKey | SFXMTYIENFMZMX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|