C19H23NO — CID 63488096
N-(3-phenoxypropyl)-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 63488096) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(3-phenoxypropyl)-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-(3-phenoxypropyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 63488096 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(3-phenoxypropyl)-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | c1ccc(OCCCNc2cccc3c2CCCC3)cc1 |
| InChI | InChI=1S/C19H23NO/c1-2-10-17(11-3-1)21-15-7-14-20-19-13-6-9-16-8-4-5-12-18(16)19/h1-3,6,9-11,13,20H,4-5,7-8,12,14-15H2 |
| InChIKey | FJJZHQSGHXOJRX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|