C15H11Br2Cl2N — CID 107787981
5-bromo-N-(4-bromo-2,3-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 107787981) has the molecular formula C15H11Br2Cl2N and a molecular weight of 435.97 g/mol. Its IUPAC name is 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107787981 |
| Molecular Formula | C15H11Br2Cl2N |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 432.86 |
| IUPAC Name | 5-bromo-N-(4-bromo-2,3-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Clc1c(Br)ccc(NC2CCc3cc(Br)ccc32)c1Cl |
| InChI | InChI=1S/C15H11Br2Cl2N/c16-9-2-3-10-8(7-9)1-5-12(10)20-13-6-4-11(17)14(18)15(13)19/h2-4,6-7,12,20H,1,5H2 |
| InChIKey | HMVLFTAIQLVGCM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|