C17H18BrClN2 — CID 63451436
4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 63451436) has the molecular formula C17H18BrClN2 and a molecular weight of 365.70 g/mol. Its IUPAC name is 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 63451436 |
| Molecular Formula | C17H18BrClN2 |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-N-(5-bromo-2,3-dihydro-1H-inden-1-yl)-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NC2CCc3cc(Br)ccc32)cc1Cl |
| InChI | InChI=1S/C17H18BrClN2/c1-21(2)17-8-5-13(10-15(17)19)20-16-7-3-11-9-12(18)4-6-14(11)16/h4-6,8-10,16,20H,3,7H2,1-2H3 |
| InChIKey | QLJFQFCGYLNKBN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|