C15H12BrCl2N — CID 55198817
5-bromo-N-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 55198817) has the molecular formula C15H12BrCl2N and a molecular weight of 357.08 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-bromo-N-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 55198817 |
| Molecular Formula | C15H12BrCl2N |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 5-bromo-N-(2,4-dichlorophenyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | Clc1ccc(NC2CCc3cc(Br)ccc32)c(Cl)c1 |
| InChI | InChI=1S/C15H12BrCl2N/c16-10-2-4-12-9(7-10)1-5-14(12)19-15-6-3-11(17)8-13(15)18/h2-4,6-8,14,19H,1,5H2 |
| InChIKey | DYEHKSNAJWUXLB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |