C19H16BrN — CID 63418541
N-(5-bromo-2,3-dihydro-1H-inden-1-yl)naphthalen-1-amine (PubChem CID 63418541) has the molecular formula C19H16BrN and a molecular weight of 338.25 g/mol. Its IUPAC name is N-(5-bromo-2,3-dihydro-1H-inden-1-yl)naphthalen-1-amine.
| Compound Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 63418541 |
| Molecular Formula | C19H16BrN |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | N-(5-bromo-2,3-dihydro-1H-inden-1-yl)naphthalen-1-amine |
| SMILES | Brc1ccc2c(c1)CCC2Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H16BrN/c20-15-9-10-17-14(12-15)8-11-19(17)21-18-7-3-5-13-4-1-2-6-16(13)18/h1-7,9-10,12,19,21H,8,11H2 |
| InChIKey | WRJOXALPMDQESW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |