C16H15Br2N — CID 61401280
5-bromo-N-[(3-bromophenyl)methyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 61401280) has the molecular formula C16H15Br2N and a molecular weight of 381.11 g/mol. Its IUPAC name is 5-bromo-N-[(3-bromophenyl)methyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-bromo-N-[(3-bromophenyl)methyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 61401280 |
| Molecular Formula | C16H15Br2N |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 5-bromo-N-[(3-bromophenyl)methyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | Brc1cccc(CNC2CCc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C16H15Br2N/c17-13-3-1-2-11(8-13)10-19-16-7-4-12-9-14(18)5-6-15(12)16/h1-3,5-6,8-9,16,19H,4,7,10H2 |
| InChIKey | SEUUHOQQXATJPI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |