About N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide
N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide (PubChem CID 52510873) has the molecular formula C18H19BrN2O
and a molecular weight of 359.27 g/mol. Its IUPAC name is N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide |
| PubChem CID | 52510873 |
| Molecular Formula | C18H19BrN2O |
| Molecular Weight | 359.27 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN[C@H]2CCc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C18H19BrN2O/c1-12(22)21-16-6-2-13(3-7-16)11-20-18-9-4-14-10-15(19)5-8-17(14)18/h2-3,5-8,10,18,20H,4,9,11H2,1H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | MTUVPLXWQVXWNL-SFHVURJKSA-N |
| XLogP | 4.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.27 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide?
The IUPAC name of N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide (CID 52510873) is N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide?
The canonical SMILES for N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide is CC(=O)Nc1ccc(CN[C@H]2CCc3cc(Br)ccc32)cc1.
What is the InChIKey of N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide?
The InChIKey is MTUVPLXWQVXWNL-SFHVURJKSA-N. The full InChI is InChI=1S/C18H19BrN2O/c1-12(22)21-16-6-2-13(3-7-16)11-20-18-9-4-14-10-15(19)5-8-17(14)18/h2-3,5-8,10,18,20H,4,9,11H2,1H3,(H,21,22)/t18-/m0/s1.
What are the key properties of N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide?
N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide has a molecular weight of 359.27 g/mol, XLogP of 4.18, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[[(1S)-5-bromo-2,3-dihydro-1H-inden-1-yl]amino]methyl]phenyl]acetamide is sourced from PubChem (CID 52510873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).