C20H24Br2N2 — CID 51041024
trans-(1S,2S)-1-N,2-N-bis[(3-bromophenyl)methyl]cyclohexane-1,2-diamine (PubChem CID 51041024) has the molecular formula C20H24Br2N2 and a molecular weight of 452.23 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis[(3-bromophenyl)methyl]cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis[(3-bromophenyl)methyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 51041024 |
| Molecular Formula | C20H24Br2N2 |
| Molecular Weight | 452.23 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis[(3-bromophenyl)methyl]cyclohexane-1,2-diamine |
| SMILES | Brc1cccc(CN[C@H]2CCCC[C@@H]2NCc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C20H24Br2N2/c21-17-7-3-5-15(11-17)13-23-19-9-1-2-10-20(19)24-14-16-6-4-8-18(22)12-16/h3-8,11-12,19-20,23-24H,1-2,9-10,13-14H2/t19-,20-/m0/s1 |
| InChIKey | VRVYMQAVBCOASZ-PMACEKPBSA-N |
| XLogP | 5.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.23 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |