C19H22BrN — CID 63454758
N-[(3-bromophenyl)methyl]-2-phenylcyclohexan-1-amine (PubChem CID 63454758) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-phenylcyclohexan-1-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-2-phenylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63454758 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-phenylcyclohexan-1-amine |
| SMILES | Brc1cccc(CNC2CCCCC2c2ccccc2)c1 |
| InChI | InChI=1S/C19H22BrN/c20-17-10-6-7-15(13-17)14-21-19-12-5-4-11-18(19)16-8-2-1-3-9-16/h1-3,6-10,13,18-19,21H,4-5,11-12,14H2 |
| InChIKey | OMSZCMJKKINERY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |