C18H22N2 — CID 43769450
2-phenyl-N-(pyridin-3-ylmethyl)cyclohexan-1-amine (PubChem CID 43769450) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-phenyl-N-(pyridin-3-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2-phenyl-N-(pyridin-3-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43769450 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-phenyl-N-(pyridin-3-ylmethyl)cyclohexan-1-amine |
| SMILES | c1ccc(C2CCCCC2NCc2cccnc2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-2-8-16(9-3-1)17-10-4-5-11-18(17)20-14-15-7-6-12-19-13-15/h1-3,6-9,12-13,17-18,20H,4-5,10-11,14H2 |
| InChIKey | VLWOBHMJSZZBJN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |