C13H18BrNO — CID 65081407
N-[(3-bromophenyl)methyl]oxepan-4-amine (PubChem CID 65081407) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]oxepan-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]oxepan-4-amine |
|---|---|
| PubChem CID | 65081407 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]oxepan-4-amine |
| SMILES | Brc1cccc(CNC2CCCOCC2)c1 |
| InChI | InChI=1S/C13H18BrNO/c14-12-4-1-3-11(9-12)10-15-13-5-2-7-16-8-6-13/h1,3-4,9,13,15H,2,5-8,10H2 |
| InChIKey | ONYLMSUDZBJCSY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |