C13H19BrN2O — CID 75499211
N'-(3-bromophenyl)-N-(oxan-4-yl)ethane-1,2-diamine (PubChem CID 75499211) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is N'-(3-bromophenyl)-N-(oxan-4-yl)ethane-1,2-diamine.
| Compound Name | N'-(3-bromophenyl)-N-(oxan-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 75499211 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | N'-(3-bromophenyl)-N-(oxan-4-yl)ethane-1,2-diamine |
| SMILES | Brc1cccc(NCCNC2CCOCC2)c1 |
| InChI | InChI=1S/C13H19BrN2O/c14-11-2-1-3-13(10-11)16-7-6-15-12-4-8-17-9-5-12/h1-3,10,12,15-16H,4-9H2 |
| InChIKey | KXVKQTFOIYUOSZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|