C12H18N2O — CID 115693261
N-(oxolan-3-yl)-N'-phenylethane-1,2-diamine (PubChem CID 115693261) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-(oxolan-3-yl)-N'-phenylethane-1,2-diamine.
| Compound Name | N-(oxolan-3-yl)-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 115693261 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-(oxolan-3-yl)-N'-phenylethane-1,2-diamine |
| SMILES | c1ccc(NCCNC2CCOC2)cc1 |
| InChI | InChI=1S/C12H18N2O/c1-2-4-11(5-3-1)13-7-8-14-12-6-9-15-10-12/h1-5,12-14H,6-10H2 |
| InChIKey | DGSBSLXCKCHUEG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|