C15H19BrCl2N2 — CID 107787547
4-bromo-2,3-dichloro-N-(2-pyrrolidin-2-ylcyclopentyl)aniline (PubChem CID 107787547) has the molecular formula C15H19BrCl2N2 and a molecular weight of 378.14 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(2-pyrrolidin-2-ylcyclopentyl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(2-pyrrolidin-2-ylcyclopentyl)aniline |
|---|---|
| PubChem CID | 107787547 |
| Molecular Formula | C15H19BrCl2N2 |
| Molecular Weight | 378.14 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(2-pyrrolidin-2-ylcyclopentyl)aniline |
| SMILES | Clc1c(Br)ccc(NC2CCCC2C2CCCN2)c1Cl |
| InChI | InChI=1S/C15H19BrCl2N2/c16-10-6-7-13(15(18)14(10)17)20-12-4-1-3-9(12)11-5-2-8-19-11/h6-7,9,11-12,19-20H,1-5,8H2 |
| InChIKey | AMJXRWMODNUBSQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.14 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|