C16H21BrCl2N2 — CID 79539499
4-bromo-2,6-dichloro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79539499) has the molecular formula C16H21BrCl2N2 and a molecular weight of 392.17 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79539499 |
| Molecular Formula | C16H21BrCl2N2 |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C16H21BrCl2N2/c17-10-8-12(18)16(13(19)9-10)21-15-5-2-1-4-11(15)14-6-3-7-20-14/h8-9,11,14-15,20-21H,1-7H2 |
| InChIKey | LEKVUVONGVZFNS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |