C16H22Br2N2 — CID 107597064
2,6-dibromo-N-(2-piperidin-2-ylcyclopentyl)aniline (PubChem CID 107597064) has the molecular formula C16H22Br2N2 and a molecular weight of 402.17 g/mol. Its IUPAC name is 2,6-dibromo-N-(2-piperidin-2-ylcyclopentyl)aniline.
| Compound Name | 2,6-dibromo-N-(2-piperidin-2-ylcyclopentyl)aniline |
|---|---|
| PubChem CID | 107597064 |
| Molecular Formula | C16H22Br2N2 |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 2,6-dibromo-N-(2-piperidin-2-ylcyclopentyl)aniline |
| SMILES | Brc1cccc(Br)c1NC1CCCC1C1CCCCN1 |
| InChI | InChI=1S/C16H22Br2N2/c17-12-6-4-7-13(18)16(12)20-15-9-3-5-11(15)14-8-1-2-10-19-14/h4,6-7,11,14-15,19-20H,1-3,5,8-10H2 |
| InChIKey | HNUULHDOYFVDAI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |