C17H24Br2N2 — CID 79540376
2,5-dibromo-N-(2-piperidin-2-ylcyclohexyl)aniline (PubChem CID 79540376) has the molecular formula C17H24Br2N2 and a molecular weight of 416.20 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-piperidin-2-ylcyclohexyl)aniline.
| Compound Name | 2,5-dibromo-N-(2-piperidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79540376 |
| Molecular Formula | C17H24Br2N2 |
| Molecular Weight | 416.20 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2,5-dibromo-N-(2-piperidin-2-ylcyclohexyl)aniline |
| SMILES | Brc1ccc(Br)c(NC2CCCCC2C2CCCCN2)c1 |
| InChI | InChI=1S/C17H24Br2N2/c18-12-8-9-14(19)17(11-12)21-16-7-2-1-5-13(16)15-6-3-4-10-20-15/h8-9,11,13,15-16,20-21H,1-7,10H2 |
| InChIKey | VJCUQASZBGCPGK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.20 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |