C17H22BrN3 — CID 82692143
5-bromo-2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzonitrile (PubChem CID 82692143) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 5-bromo-2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzonitrile.
| Compound Name | 5-bromo-2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 82692143 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 5-bromo-2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzonitrile |
| SMILES | N#Cc1cc(Br)ccc1NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C17H22BrN3/c18-13-7-8-15(12(10-13)11-19)21-17-5-2-1-4-14(17)16-6-3-9-20-16/h7-8,10,14,16-17,20-21H,1-6,9H2 |
| InChIKey | WHARBWZJOOASGX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |