C17H25FN2 — CID 79546014
2-fluoro-4-methyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79546014) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-fluoro-4-methyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 2-fluoro-4-methyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79546014 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-fluoro-4-methyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Cc1ccc(NC2CCCCC2C2CCCN2)c(F)c1 |
| InChI | InChI=1S/C17H25FN2/c1-12-8-9-17(14(18)11-12)20-16-6-3-2-5-13(16)15-7-4-10-19-15/h8-9,11,13,15-16,19-20H,2-7,10H2,1H3 |
| InChIKey | BFICAAHAEDQICU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |