C19H30N2 — CID 79536673
2,4,6-trimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79536673) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 2,4,6-trimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79536673 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 2,4,6-trimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Cc1cc(C)c(NC2CCCCC2C2CCCN2)c(C)c1 |
| InChI | InChI=1S/C19H30N2/c1-13-11-14(2)19(15(3)12-13)21-18-8-5-4-7-16(18)17-9-6-10-20-17/h11-12,16-18,20-21H,4-10H2,1-3H3 |
| InChIKey | FLMKRLJLDURWSS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |