C16H28N4 — CID 79553657
3,5-dimethyl-N-(2-piperidin-2-ylcyclohexyl)-1H-pyrazol-4-amine (PubChem CID 79553657) has the molecular formula C16H28N4 and a molecular weight of 276.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(2-piperidin-2-ylcyclohexyl)-1H-pyrazol-4-amine.
| Compound Name | 3,5-dimethyl-N-(2-piperidin-2-ylcyclohexyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 79553657 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 3,5-dimethyl-N-(2-piperidin-2-ylcyclohexyl)-1H-pyrazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1NC1CCCCC1C1CCCCN1 |
| InChI | InChI=1S/C16H28N4/c1-11-16(12(2)20-19-11)18-15-9-4-3-7-13(15)14-8-5-6-10-17-14/h13-15,17-18H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | VDPWUICIVJLFLW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |