C18H28N2 — CID 79546508
2,3-dimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79546508) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 2,3-dimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 2,3-dimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79546508 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2,3-dimethyl-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Cc1cccc(NC2CCCCC2C2CCCN2)c1C |
| InChI | InChI=1S/C18H28N2/c1-13-7-5-10-16(14(13)2)20-18-9-4-3-8-15(18)17-11-6-12-19-17/h5,7,10,15,17-20H,3-4,6,8-9,11-12H2,1-2H3 |
| InChIKey | JDEXWWJYZONOJY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |