C17H24N2O2 — CID 79539513
2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzoic acid (PubChem CID 79539513) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzoic acid.
| Compound Name | 2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 79539513 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[(2-pyrrolidin-2-ylcyclohexyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C17H24N2O2/c20-17(21)13-7-2-4-9-16(13)19-15-8-3-1-6-12(15)14-10-5-11-18-14/h2,4,7,9,12,14-15,18-19H,1,3,5-6,8,10-11H2,(H,20,21) |
| InChIKey | GDZWKEWIBSZYDT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |